Record Information |
---|
HMDB Status | quantified |
---|
Creation Date | 2024-02-20 23:33:24 UTC |
---|
Update Date | 2025-03-21 17:56:05 UTC |
---|
HMDB ID | HMDB0000050 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00000027 |
---|
Name | Adenosine |
---|
Frequency | 36040.8 |
---|
Structure | |
---|
Chemical Formula | C10H13N5O4 |
---|
Molecular Mass | 267.0968 |
---|
SMILES | Nc1ncnc2c1ncn2C1OC(CO)C(O)C1O |
---|
InChI Key | OIRDTQYFTABQOQ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | nucleosides, nucleotides, and analogues |
---|
Class | purine nucleosides |
---|
Subclass | purine nucleosides |
---|
Direct Parent | purine nucleosides |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonosaccharidesn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholstetrahydrofurans |
---|
Substituents | monosaccharideimidazopyrimidinepyrimidinesaccharidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranpurine nucleosideheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
---|