DeepMet

Record Information
HMDB Status	detected
Creation Date	2024-02-20 23:33:26 UTC
Update Date	2025-03-21 17:56:06 UTC
HMDB ID	HMDB0259337
Metabolite Identification
DeepMet ID	DMID00000118
Name	Tyr-Gly
Frequency	22857.7
Structure
Chemical Formula	C₁₁H₁₄N₂O₄
Molecular Mass	238.0954
SMILES	NC(Cc1ccc(O)cc1)C(=O)NCC(=O)O
InChI Key	HPYDSVWYXXKHRD-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic acids and derivatives
Class	carboxylic acids and derivatives
Subclass	amino acids, peptides, and analogues
Direct Parent	acyl glycines
Geometric Descriptor	aromatic homomonocyclic compounds
Alternative Parents	1-hydroxy-2-unsubstituted benzenoids alpha amino acid amides alpha amino acids amphetamines and derivatives benzene and substituted derivatives carbonyl compounds carboxylic acids dipeptides fatty amides hydrocarbon derivatives monoalkylamines monocarboxylic acids and derivatives organic oxides organonitrogen compounds organopnictogen compounds phenylalanine and derivatives secondary carboxylic acid amides tyrosine and derivatives
Substituents	fatty acyl monocyclic benzene moiety carbonyl group carboxylic acid fatty amide 1-hydroxy-2-unsubstituted benzenoid alpha peptide organic oxide organonitrogen compound alpha-amino acid organopnictogen compound amphetamine or derivatives tyrosine or derivatives alpha-amino acid amide carboxamide group n-acylglycine aromatic homomonocyclic compound alpha-dipeptide secondary carboxylic acid amide monocarboxylic acid or derivatives phenylalanine or derivatives organic oxygen compound phenol hydrocarbon derivative benzenoid primary aliphatic amine organic nitrogen compound organooxygen compound

Showing information for DMID00000118