| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:33:27 UTC |
|---|
| Update Date | 2025-03-21 17:56:06 UTC |
|---|
| HMDB ID | HMDB0003379 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00000127 |
|---|
| Name | Triphosphate |
|---|
| Frequency | 22049.0 |
|---|
| Structure | |
|---|
| Chemical Formula | H5O10P3 |
|---|
| Molecular Mass | 257.9096 |
|---|
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)O |
|---|
| InChI Key | UNXRWKVEANCORM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | organic phosphoric acids and derivatives |
|---|
| Direct Parent | organic phosphoric acids and derivatives |
|---|
| Geometric Descriptor | acyclic compounds |
|---|
| Alternative Parents | organic oxides |
|---|
| Substituents | organic oxideorganic oxygen compoundacyclic compoundorganic phosphoric acid derivative |
|---|
