| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:33:29 UTC |
|---|
| Update Date | 2025-03-21 17:56:07 UTC |
|---|
| HMDB ID | HMDB0061739 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00000218 |
|---|
| Name | Perfluorononanoic acid |
|---|
| Frequency | 17012.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C9HF17O2 |
|---|
| Molecular Mass | 463.9705 |
|---|
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
| InChI Key | UZUFPBIDKMEQEQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organohalogen compounds |
|---|
| Class | alkyl halides |
|---|
| Subclass | alkyl fluorides |
|---|
| Direct Parent | perfluorooctanoic acid and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesalpha-halocarboxylic acidscarbonyl compoundscarboxylic acidshalogenated fatty acidshydrocarbon derivativesmedium-chain fatty acidsmonocarboxylic acids and derivativesorganic oxidesorganofluorides |
|---|
| Substituents | halogenated fatty acidalpha-halocarboxylic acid or derivativesfatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidorganofluoridefatty acidperfluorooctanoic acid or derivativesalpha-halocarboxylic acidcarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativemedium-chain fatty acidorganooxygen compound |
|---|