Record Information |
---|
HMDB Status | quantified |
---|
Creation Date | 2024-02-20 23:33:29 UTC |
---|
Update Date | 2025-03-21 17:56:07 UTC |
---|
HMDB ID | HMDB0061739 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00000218 |
---|
Name | Perfluorononanoic acid |
---|
Frequency | 17012.0 |
---|
Structure | |
---|
Chemical Formula | C9HF17O2 |
---|
Molecular Mass | 463.9705 |
---|
SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
---|
InChI Key | UZUFPBIDKMEQEQ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organohalogen compounds |
---|
Class | alkyl halides |
---|
Subclass | alkyl fluorides |
---|
Direct Parent | perfluorooctanoic acid and derivatives |
---|
Geometric Descriptor | aliphatic acyclic compounds |
---|
Alternative Parents | alkyl fluoridesalpha-halocarboxylic acidscarbonyl compoundscarboxylic acidshalogenated fatty acidshydrocarbon derivativesmedium-chain fatty acidsmonocarboxylic acids and derivativesorganic oxidesorganofluorides |
---|
Substituents | halogenated fatty acidalpha-halocarboxylic acid or derivativesfatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidorganofluoridefatty acidperfluorooctanoic acid or derivativesalpha-halocarboxylic acidcarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativemedium-chain fatty acidorganooxygen compound |
---|