Record Information |
---|
HMDB Status | quantified |
---|
Creation Date | 2024-02-20 23:33:30 UTC |
---|
Update Date | 2025-03-21 17:56:07 UTC |
---|
HMDB ID | HMDB0010738 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00000252 |
---|
Name | 1-Methylxanthine |
---|
Frequency | 18688.4 |
---|
Structure | |
---|
Chemical Formula | C6H6N4O2 |
---|
Molecular Mass | 166.0491 |
---|
SMILES | Cn1c(=O)[nH]c2nc[nH]c2c1=O |
---|
InChI Key | MVOYJPOZRLFTCP-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | imidazopyrimidines |
---|
Subclass | purines and purine derivatives |
---|
Direct Parent | purinones |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrimidonesvinylogous amides |
---|
Substituents | vinylogous amidecarbonic acid derivativelactamazacycleheteroaromatic compoundpyrimidonepurinonepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundazole |
---|