Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-20 23:33:30 UTC |
---|
Update Date | 2025-03-21 17:56:07 UTC |
---|
HMDB ID | HMDB0029098 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00000258 |
---|
Name | Tyrosyl-Alanine |
---|
Frequency | 19554.7 |
---|
Structure | |
---|
Chemical Formula | C12H16N2O4 |
---|
Molecular Mass | 252.111 |
---|
SMILES | CC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)O |
---|
InChI Key | NLKUJNGEGZDXGO-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | dipeptides |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalanine and derivativesalpha amino acid amidesalpha amino acidsamphetamines and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acidsfatty amideshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylalanine and derivativessecondary carboxylic acid amidestyrosine and derivatives |
---|
Substituents | fatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acidfatty amide1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativesorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundamphetamine or derivativesn-acyl-alpha amino acid or derivativestyrosine or derivativesalpha-amino acid amiden-acyl-alpha-amino acidcarboxamide grouparomatic homomonocyclic compoundalpha-dipeptidesecondary carboxylic acid amidemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundalanine or derivativesphenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
---|