Record Information |
---|
HMDB Status | quantified |
---|
Creation Date | 2024-02-20 23:33:37 UTC |
---|
Update Date | 2025-03-21 17:56:11 UTC |
---|
HMDB ID | HMDB0010319 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00000543 |
---|
Name | Indoxyl glucuronide |
---|
Frequency | 9786.5 |
---|
Structure | |
---|
Chemical Formula | C14H15NO7 |
---|
Molecular Mass | 309.0849 |
---|
SMILES | O=C(O)C1OC(Oc2c[nH]c3ccccc23)C(O)C(O)C1O |
---|
InChI Key | KUYNOZVWCFXSNE-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | o-glucuronides |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | acetalsazacyclic compoundsbenzenoidsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativesheteroaromatic compoundshydrocarbon derivativesindolesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidspyrrolessecondary alcohols |
---|
Substituents | carbonyl groupcarboxylic acidindoleo-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesazacycleheteroaromatic compoundindole or derivativeshydroxy acidoxacyclemonocarboxylic acid or derivativespyranpyrrolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compound |
---|