| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:33:38 UTC |
|---|
| Update Date | 2025-03-21 17:56:11 UTC |
|---|
| HMDB ID | HMDB0002032 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00000589 |
|---|
| Name | 8-Hydroxyguanine |
|---|
| Frequency | 12559.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H5N5O2 |
|---|
| Molecular Mass | 167.0443 |
|---|
| SMILES | Nc1nc(=O)c2[nH]c(=O)[nH]c2[nH]1 |
|---|
| InChI Key | CLGFIVUFZRGQRP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesorganic carbonic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrimidonesvinylogous amides |
|---|
| Substituents | vinylogous amidecarbonic acid derivativeazacycleheteroaromatic compoundpyrimidonepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundhypoxanthinehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compoundazole |
|---|