Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-20 23:33:39 UTC |
---|
Update Date | 2025-03-21 17:56:12 UTC |
---|
HMDB ID | HMDB0132500 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00000617 |
---|
Name | 2-[4-(sulfooxy)phenyl]acetic acid |
---|
Frequency | 8860.9 |
---|
Structure | |
---|
Chemical Formula | C8H8O6S |
---|
Molecular Mass | 232.0042 |
---|
SMILES | O=C(O)Cc1ccc(OS(=O)(=O)O)cc1 |
---|
InChI Key | IIODELUADFSHIZ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | organic sulfuric acids and derivatives |
---|
Subclass | arylsulfates |
---|
Direct Parent | phenylsulfates |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundssulfuric acid monoesters |
---|
Substituents | monocyclic benzene moietysulfuric acid monoestercarbonyl groupcarboxylic acidcarboxylic acid derivativearomatic homomonocyclic compoundphenylsulfateorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsulfate-esterhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
---|