| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:33:39 UTC |
|---|
| Update Date | 2025-03-21 17:56:12 UTC |
|---|
| HMDB ID | HMDB0000296 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00000646 |
|---|
| Name | Uridine |
|---|
| Frequency | 8552.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N2O6 |
|---|
| Molecular Mass | 244.0695 |
|---|
| SMILES | O=c1nc(O)ccn1C1OC(CO)C(O)C1O |
|---|
| InChI Key | DRTQHJPVMGBUCF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrimidine nucleosides |
|---|
| Subclass | pyrimidine nucleosides |
|---|
| Direct Parent | pyrimidine nucleosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidinesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspyrimidonessecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholcarbonic acid derivativearomatic heteromonocyclic compoundazacycletetrahydrofuranheteroaromatic compoundmonosaccharidepyrimidonehydroxypyrimidinepyrimidineoxacyclesaccharideorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativepyrimidine nucleosideorganic nitrogen compoundprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|
