Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-20 23:33:41 UTC |
---|
Update Date | 2025-03-21 17:56:13 UTC |
---|
HMDB ID | HMDB0029095 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00000697 |
---|
Name | Tryptophyl-Tyrosine |
---|
Frequency | 8149.5 |
---|
Structure | |
---|
Chemical Formula | C20H21N3O4 |
---|
Molecular Mass | 367.1532 |
---|
SMILES | NC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
---|
InChI Key | TYYLDKGBCJGJGW-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | dipeptides |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsamphetamines and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acidsfatty amidesheteroaromatic compoundshydrocarbon derivativesindolesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylalanine and derivativesphenylpropanoic acidspyrrolessecondary carboxylic acid amidestyrosine and derivatives |
---|
Substituents | fatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acidindolefatty amide1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativesorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundamphetamine or derivativesn-acyl-alpha amino acid or derivativestyrosine or derivativesalpha-amino acid amideazacyclen-acyl-alpha-amino acidheteroaromatic compoundindole or derivativescarboxamide groupalpha-dipeptidesecondary carboxylic acid amidemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundpyrrolephenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
---|