| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:33:43 UTC |
|---|
| Update Date | 2025-03-21 17:56:15 UTC |
|---|
| HMDB ID | HMDB0002004 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00000775 |
|---|
| Name | 5-Methoxydimethyltryptamine |
|---|
| Frequency | 7223.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18N2O |
|---|
| Molecular Mass | 218.1419 |
|---|
| SMILES | COc1ccc2[nH]cc(CCN(C)C)c2c1 |
|---|
| InChI Key | ZSTKHSQDNIGFLM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | Not Available |
|---|
| Subclass | alkaloids and derivatives |
|---|
| Direct Parent | alkaloids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesindolesorganopnictogen compoundspyrrolestrialkylamines |
|---|
| Substituents | phenol etheretherazacycleindoleheteroaromatic compoundtertiary aliphatic amineindole or derivativesalkyl aryl etheralkaloid or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundanisolepyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundaminetertiary amineorganoheterocyclic compoundorganooxygen compound |
|---|