Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-20 23:33:44 UTC |
---|
Update Date | 2025-03-21 17:56:16 UTC |
---|
HMDB ID | HMDB0029001 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00000824 |
---|
Name | Phenylalanylmethionine |
---|
Frequency | 7127.5 |
---|
Structure | |
---|
Chemical Formula | C14H20N2O3S |
---|
Molecular Mass | 296.1195 |
---|
SMILES | CSCCC(NC(=O)C(N)Cc1ccccc1)C(=O)O |
---|
InChI Key | PYOHODCEOHCZBM-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | dipeptides |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alpha amino acid amidesalpha amino acidsamphetamines and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acidsdialkylthioethersfatty amideshydrocarbon derivativesmethionine and derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylalanine and derivativessecondary carboxylic acid amidessulfenyl compoundsthia fatty acids |
---|
Substituents | fatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acidfatty amidealpha-amino acid or derivativesorganosulfur compoundorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundamphetamine or derivativesn-acyl-alpha amino acid or derivativessulfenyl compoundalpha-amino acid amiden-acyl-alpha-amino aciddialkylthioethercarboxamide grouparomatic homomonocyclic compoundalpha-dipeptidesecondary carboxylic acid amidemonocarboxylic acid or derivativesthia fatty acidphenylalanine or derivativesorganic oxygen compoundthioethermethionine or derivativeshydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
---|