| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:33:45 UTC |
|---|
| Update Date | 2025-03-21 17:56:22 UTC |
|---|
| HMDB ID | HMDB0029092 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00000884 |
|---|
| Name | Tryptophyl-Serine |
|---|
| Frequency | 7440.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H17N3O4 |
|---|
| Molecular Mass | 291.1219 |
|---|
| SMILES | NC(Cc1c[nH]c2ccccc12)C(=O)NC(CO)C(=O)O |
|---|
| InChI Key | MYVYPSWUSKCCHG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | dipeptides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha amino acid amidesalpha amino acidsazacyclic compoundsbenzenoidsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsfatty amidesheteroaromatic compoundshydrocarbon derivativesindolesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary alcoholspyrrolessecondary carboxylic acid amidesserine and derivatives |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidindolefatty amidealpha-amino acid or derivativesbeta-hydroxy acidorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundprimary alcoholorganoheterocyclic compoundn-acyl-alpha amino acid or derivativesalcoholalpha-amino acid amideazacyclen-acyl-alpha-amino acidheteroaromatic compoundindole or derivativeshydroxy acidcarboxamide groupalpha-dipeptidesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundpyrrolehydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundserine or derivativesorganooxygen compound |
|---|
