Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:33:46 UTC |
---|
Update Date | 2025-03-21 17:56:22 UTC |
---|
HMDB ID | HMDB0125166 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00000906 |
---|
Name | p-Coumaric acid sulfate |
---|
Frequency | 6245.5 |
---|
Structure | |
---|
Chemical Formula | C9H8O6S |
---|
Molecular Mass | 244.0042 |
---|
SMILES | O=C(O)C=Cc1ccc(OS(=O)(=O)O)cc1 |
---|
InChI Key | OYDCCWNLILCHDJ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | cinnamic acids and derivatives |
---|
Subclass | cinnamic acids and derivatives |
---|
Direct Parent | cinnamic acids and derivatives |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundsphenylsulfatessulfuric acid monoesters |
---|
Substituents | monocyclic benzene moietycarbonyl groupsulfuric acid monoestercarboxylic acidorganic sulfuric acid or derivativescarboxylic acid derivativearomatic homomonocyclic compoundphenylsulfatecinnamic acid or derivativesorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsulfate-esterhydrocarbon derivativearylsulfatebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
---|