| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:33:51 UTC |
|---|
| Update Date | 2025-03-21 17:56:24 UTC |
|---|
| HMDB ID | HMDB0000978 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00001135 |
|---|
| Name | 4-(2-Aminophenyl)-2,4-dioxobutanoic acid |
|---|
| Frequency | 5123.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9NO4 |
|---|
| Molecular Mass | 207.0532 |
|---|
| SMILES | Nc1ccccc1C(=O)CC(=O)C(=O)O |
|---|
| InChI Key | CAOVWYZQMPNAFJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha-hydroxy ketonesalpha-keto acids and derivativesamino acidsaryl alkyl ketonesbenzoyl derivativesbutyrophenonescarboxylic acidsgamma-keto acids and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsprimary aminesvinylogous amides |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidaryl alkyl ketoneamino acid or derivativesamino acidbenzoylalpha-hydroxy ketonecarboxylic acid derivativeorganic oxideorganonitrogen compoundalpha-keto acidorganopnictogen compoundvinylogous amidegamma-keto acidbutyrophenonearomatic homomonocyclic compoundmonocarboxylic acid or derivativesketo acidhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundaminealkyl-phenylketone |
|---|
