Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-20 23:33:52 UTC |
---|
Update Date | 2025-03-21 17:56:24 UTC |
---|
HMDB ID | HMDB0013695 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00001153 |
---|
Name | Urolithin A |
---|
Frequency | 5062.0 |
---|
Structure | |
---|
Chemical Formula | C13H8O4 |
---|
Molecular Mass | 228.0423 |
---|
SMILES | O=c1oc2cc(O)ccc2c2ccc(O)cc12 |
---|
InChI Key | RIUPLDUFZCXCHM-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | coumarins and derivatives |
---|
Subclass | coumarins and derivatives |
---|
Direct Parent | coumarins and derivatives |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids2-benzopyransbenzenoidsheteroaromatic compoundshydrocarbon derivativesisocoumarins and derivativeslactonesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
---|
Substituents | benzopyran1-benzopyranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidisocoumarincoumarinlactoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyran2-benzopyranpyranonehydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
---|