| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:33:52 UTC |
|---|
| Update Date | 2025-03-21 17:56:24 UTC |
|---|
| HMDB ID | HMDB0000763 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00001159 |
|---|
| Name | 5-Hydroxyindoleacetic acid |
|---|
| Frequency | 5035.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9NO3 |
|---|
| Molecular Mass | 191.0582 |
|---|
| SMILES | O=C(O)Cc1c[nH]c2ccc(O)cc12 |
|---|
| InChI Key | DUUGKQCEGZLZNO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrroles |
|---|
| Substituents | carbonyl groupcarboxylic acidazacycleindoleheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
