| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:33:53 UTC |
|---|
| Update Date | 2025-03-21 17:56:25 UTC |
|---|
| HMDB ID | HMDB0000071 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00001183 |
|---|
| Name | Deoxyinosine |
|---|
| Frequency | 9612.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12N4O4 |
|---|
| Molecular Mass | 252.0859 |
|---|
| SMILES | OCC1OC(n2cnc3c(O)ncnc32)CC1O |
|---|
| InChI Key | VGONTNSXDCQUGY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine 2'-deoxyribonucleosides |
|---|
| Direct Parent | purine 2'-deoxyribonucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidinesimidazolesmonosaccharidesn-substituted imidazolesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspurines and purine derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | monosaccharidehydroxypyrimidineimidazopyrimidinepyrimidinesaccharidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholpurine 2'-deoxyribonucleosideorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativepurineorganic nitrogen compoundorganooxygen compound |
|---|