Record Information |
---|
HMDB Status | quantified |
---|
Creation Date | 2024-02-20 23:33:53 UTC |
---|
Update Date | 2025-03-21 17:56:25 UTC |
---|
HMDB ID | HMDB0000071 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00001183 |
---|
Name | Deoxyinosine |
---|
Frequency | 9612.0 |
---|
Structure | |
---|
Chemical Formula | C10H12N4O4 |
---|
Molecular Mass | 252.0859 |
---|
SMILES | OCC1OC(n2cnc3c(O)ncnc32)CC1O |
---|
InChI Key | VGONTNSXDCQUGY-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | nucleosides, nucleotides, and analogues |
---|
Class | purine nucleosides |
---|
Subclass | purine 2'-deoxyribonucleosides |
---|
Direct Parent | purine 2'-deoxyribonucleosides |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidinesimidazolesmonosaccharidesn-substituted imidazolesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspurines and purine derivativessecondary alcoholstetrahydrofurans |
---|
Substituents | monosaccharidehydroxypyrimidineimidazopyrimidinepyrimidinesaccharidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholpurine 2'-deoxyribonucleosideorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativepurineorganic nitrogen compoundorganooxygen compound |
---|