| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:33:53 UTC |
|---|
| Update Date | 2025-03-21 17:56:25 UTC |
|---|
| HMDB ID | HMDB0001132 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00001187 |
|---|
| Name | Nicotinic acid mononucleotide |
|---|
| Frequency | 4915.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H15NO9P+ |
|---|
| Molecular Mass | 336.0479 |
|---|
| SMILES | O=C(O)c1ccc[n+](C2OC(COP(=O)(O)O)C(O)C2O)c1 |
|---|
| InChI Key | JOUIQRNQJGXQDC-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyridine nucleotides |
|---|
| Subclass | nicotinic acid nucleotides |
|---|
| Direct Parent | nicotinic acid nucleotides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic cationsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspentose phosphatespyridine-3-carboxylic acidssecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | pyridine carboxylic acid or derivativescarboxylic acidaromatic heteromonocyclic compoundpentose phosphatepyridine-3-carboxylic acidmonosaccharidepentose-5-phosphatecarboxylic acid derivativesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundorganic cationorganoheterocyclic compound1,2-diolalcoholvinylogous amideazacycletetrahydrofuranheteroaromatic compoundhydroxypyridinenicotinic-acid-nucleotideoxacyclemonocarboxylic acid or derivativespyridineorganic oxygen compoundphosphoric acid estermonoalkyl phosphatepyridine carboxylic acidsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
