Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:33:53 UTC |
---|
Update Date | 2025-03-21 17:56:25 UTC |
---|
HMDB ID | HMDB0240437 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00001208 |
---|
Name | Catechin 3-sulfate |
---|
Frequency | 4795.4 |
---|
Structure | |
---|
Chemical Formula | C15H14O9S |
---|
Molecular Mass | 370.0359 |
---|
SMILES | O=S(=O)(O)OC1Cc2c(O)cc(O)cc2OC1c1ccc(O)c(O)c1 |
---|
InChI Key | FLSYXGAHKYHTCZ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | flavonoids |
---|
Subclass | flavans |
---|
Direct Parent | catechins |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids3-sulfated flavonoids4'-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersalkyl sulfatesbenzene and substituted derivativeshydrocarbon derivativesorganic oxidesoxacyclic compoundssulfuric acid monoesters |
---|
Substituents | monocyclic benzene moietysulfuric acid monoesterether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxidearomatic heteropolycyclic compoundalkyl sulfatechromanecatechinorganoheterocyclic compoundbenzopyranorganic sulfuric acid or derivatives3-sulfated flavonoid5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacycleorganic oxygen compound7-hydroxyflavonoid4'-hydroxyflavonoidsulfate-esterphenolhydrocarbon derivativebenzenoidsulfuric acid esterorganooxygen compound |
---|