| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:33:56 UTC |
|---|
| Update Date | 2025-03-21 17:56:26 UTC |
|---|
| HMDB ID | HMDB0029620 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00001323 |
|---|
| Name | Tricetin |
|---|
| Frequency | 4396.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O7 |
|---|
| Molecular Mass | 302.0427 |
|---|
| SMILES | O=c1cc(-c2cc(O)c(O)c(O)c2)oc2cc(O)cc(O)c12 |
|---|
| InChI Key | ARSRJFRKVXALTF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 5-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids4'-hydroxyflavonoids7-hydroxyflavonoidsbenzene and substituted derivativeschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativespyrogallols and derivativesvinylogous acids |
|---|
| Substituents | monocyclic benzene moiety1-benzopyran1-hydroxy-2-unsubstituted benzenoidorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyranpyrogallol derivativebenzenetriolheteroaromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacyclevinylogous acidorganic oxygen compoundpyran7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
