Record Information |
---|
HMDB Status | quantified |
---|
Creation Date | 2024-02-20 23:34:01 UTC |
---|
Update Date | 2025-03-21 17:56:28 UTC |
---|
HMDB ID | HMDB0003306 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00001505 |
---|
Name | Phloretin |
---|
Frequency | 3931.0 |
---|
Structure | |
---|
Chemical Formula | C15H14O5 |
---|
Molecular Mass | 274.0841 |
---|
SMILES | O=C(CCc1ccc(O)cc1)c1c(O)cc(O)cc1O |
---|
InChI Key | VGEREEWJJVICBM-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | linear 1,3-diarylpropanoids |
---|
Subclass | chalcones and dihydrochalcones |
---|
Direct Parent | 2'-hydroxy-dihydrochalcones |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacylphloroglucinols and derivativesalkyl-phenylketonesaryl alkyl ketonesbenzoyl derivativesbutyrophenonescinnamylphenolshydrocarbon derivativesorganic oxidesorganooxygen compoundsvinylogous acids |
---|
Substituents | monocyclic benzene moiety2'-hydroxy-dihydrochalconearyl alkyl ketonebenzoyl1-hydroxy-2-unsubstituted benzenoidcinnamylphenolketonephloroglucinol derivativeorganic oxideacylphloroglucinol derivativebenzenetriol1-hydroxy-4-unsubstituted benzenoidphenylketonebutyrophenonearomatic homomonocyclic compoundvinylogous acidorganic oxygen compoundphenolhydrocarbon derivativebenzenoidalkyl-phenylketoneorganooxygen compoundaryl ketone |
---|