Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-20 23:34:01 UTC |
---|
Update Date | 2025-03-21 17:56:28 UTC |
---|
HMDB ID | HMDB0059982 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00001524 |
---|
Name | 4-hydroxybenzoic acid-4-O-sulphate |
---|
Frequency | 3876.0 |
---|
Structure | |
---|
Chemical Formula | C7H6O6S |
---|
Molecular Mass | 217.9885 |
---|
SMILES | O=C(O)c1ccc(OS(=O)(=O)O)cc1 |
---|
InChI Key | RJTYSXVYCZAUHE-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | organic sulfuric acids and derivatives |
---|
Subclass | arylsulfates |
---|
Direct Parent | phenylsulfates |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | benzoic acidsbenzoyl derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsphenoxy compoundssulfuric acid monoesters |
---|
Substituents | monocyclic benzene moietysulfuric acid monoestercarboxylic acidbenzoylbenzoic acid or derivativescarboxylic acid derivativearomatic homomonocyclic compoundphenylsulfateorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsulfate-esterhydrocarbon derivativebenzenoidbenzoic acidphenoxy compoundsulfuric acid esterorganooxygen compound |
---|