| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:34:02 UTC |
|---|
| Update Date | 2025-03-21 17:56:28 UTC |
|---|
| HMDB ID | HMDB0301880 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00001555 |
|---|
| Name | Apigeninidin |
|---|
| Frequency | 3809.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H11O4+ |
|---|
| Molecular Mass | 255.0652 |
|---|
| SMILES | Oc1ccc(-c2ccc3c(O)cc(O)cc3[o+]2)cc1 |
|---|
| InChI Key | ZKMZBAABQFUXFE-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 5-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids4'-hydroxyflavonoids7-hydroxyflavonoidsanthocyanidinsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesorganic cationsorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | monocyclic benzene moietybenzopyran1-benzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidoxacycleorganic oxygen compoundaromatic heteropolycyclic compound7-hydroxyflavonoid4'-hydroxyflavonoidanthocyanidinphenolhydrocarbon derivativebenzenoidorganic cationorganoheterocyclic compoundorganooxygen compound |
|---|
