| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:34:02 UTC |
|---|
| Update Date | 2025-03-21 17:56:28 UTC |
|---|
| HMDB ID | HMDB0132457 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00001560 |
|---|
| Name | 5,7-dihydroxy-2-(4-methoxyphenyl)-4H-chromen-4-one |
|---|
| Frequency | 3799.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O5 |
|---|
| Molecular Mass | 284.0685 |
|---|
| SMILES | COc1ccc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc1 |
|---|
| InChI Key | DANYIYRPLHHOCZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | o-methylated flavonoids |
|---|
| Direct Parent | 4'-o-methylated flavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids5-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersanisoleschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesmethoxybenzenesorganic oxidesoxacyclic compoundsphenoxy compoundspyranones and derivativesvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoidmethoxybenzeneoxacyclevinylogous acidorganic oxygen compoundpyrananisole7-hydroxyflavonoid4p-methoxyflavonoid-skeletonhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|
