| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:34:02 UTC |
|---|
| Update Date | 2025-03-21 17:56:28 UTC |
|---|
| HMDB ID | HMDB0247775 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00001563 |
|---|
| Name | 3-[[(2R)-2-Acetamido-2-carboxyethyl]disulfanyl]-2-aminopropanoic acid |
|---|
| Frequency | 3806.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H14N2O5S2 |
|---|
| Molecular Mass | 282.0344 |
|---|
| SMILES | CC(=O)NC(CSSCC(N)C(=O)O)C(=O)O |
|---|
| InChI Key | ZLCOWUKVVFVVKA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | n-acyl-alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acetamidesalpha amino acidscarbonyl compoundscarboxylic acidscysteine and derivativesdialkyldisulfidesdicarboxylic acids and derivativeshydrocarbon derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amidessulfenyl compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidorganosulfur compoundorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundacetamidesulfenyl compoundn-acyl-alpha-amino acidcarboxamide groupsecondary carboxylic acid amidedialkyldisulfideorganic oxygen compoundorganic disulfidecysteine or derivativesdicarboxylic acid or derivativeshydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
