| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:34:02 UTC |
|---|
| Update Date | 2025-03-21 17:56:29 UTC |
|---|
| HMDB ID | HMDB0001294 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00001572 |
|---|
| Name | 2,3-Diphosphoglyceric acid |
|---|
| Frequency | 3765.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H8O10P2 |
|---|
| Molecular Mass | 265.9593 |
|---|
| SMILES | O=C(O)C(COP(=O)(O)O)OP(=O)(O)O |
|---|
| InChI Key | XOHUEYCVLUUEJJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | sugar acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidcarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesphosphoric acid esterglyceric_acidmonoalkyl phosphatehydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
