| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:34:03 UTC |
|---|
| Update Date | 2025-03-21 17:56:28 UTC |
|---|
| HMDB ID | HMDB0041681 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00001585 |
|---|
| Name | 4-Hydroxyenterodiol |
|---|
| Frequency | 3742.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H22O5 |
|---|
| Molecular Mass | 318.1467 |
|---|
| SMILES | OCC(Cc1cccc(O)c1)C(CO)Cc1ccc(O)c(O)c1 |
|---|
| InChI Key | SSJFHTSLUHPBHD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | dibenzylbutane lignans |
|---|
| Subclass | dibenzylbutane lignans |
|---|
| Direct Parent | dibenzylbutane lignans |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativeshydrocarbon derivativesprimary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moiety1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compounddibenzylbutane lignan skeletonorganic oxygen compoundphenolhydrocarbon derivativebenzenoidprimary alcoholorganooxygen compound |
|---|
