| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:34:07 UTC |
|---|
| Update Date | 2025-03-21 17:56:30 UTC |
|---|
| HMDB ID | HMDB0135181 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00001742 |
|---|
| Name | 3,4,5-trihydroxy-6-(4-hydroxyphenoxy)oxane-2-carboxylic acid |
|---|
| Frequency | 3472.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H14O8 |
|---|
| Molecular Mass | 286.0689 |
|---|
| SMILES | O=C(O)C1OC(Oc2ccc(O)cc2)C(O)C(O)C1O |
|---|
| InChI Key | KCWGTTYNHQOGSJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids4-alkoxyphenolsacetalsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundspyran carboxylic acidssecondary alcohols |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundo-glucuronide1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetaloxaneorganoheterocyclic compoundalcohol4-alkoxyphenolpyran carboxylic acid or derivativeshydroxy acidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholphenolhydrocarbon derivativebenzenoidphenoxy compound |
|---|
