| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:34:09 UTC |
|---|
| Update Date | 2025-03-21 17:56:31 UTC |
|---|
| HMDB ID | HMDB0240372 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00001834 |
|---|
| Name | 3-Phenylpropionic acid sulfate |
|---|
| Frequency | 3305.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10O5S |
|---|
| Molecular Mass | 230.0249 |
|---|
| SMILES | O=C(CCc1ccccc1)OS(=O)(=O)O |
|---|
| InChI Key | LRJRUWWLXQZANS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessulfuric acid monoesters |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoestercarbonyl grouporganic sulfuric acid or derivativescarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativesulfuric acid esterorganooxygen compound |
|---|
