| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:34:11 UTC |
|---|
| Update Date | 2025-03-21 17:56:31 UTC |
|---|
| HMDB ID | HMDB0240552 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00001891 |
|---|
| Name | Phenylalanine betaine |
|---|
| Frequency | 3215.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H18NO2+ |
|---|
| Molecular Mass | 208.1332 |
|---|
| SMILES | C[N+](C)(C)C(Cc1ccccc1)C(=O)O |
|---|
| InChI Key | XTFQIRIHLGODFV-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | phenylalanine and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsaminesamphetamines and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsphenylpropanoic acidstetraalkylammonium salts |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acidorganic oxidealpha-amino acidorganonitrogen compoundorganopnictogen compoundorganic cationorganic saltamphetamine or derivativestetraalkylammonium saltquaternary ammonium saltaromatic homomonocyclic compoundmonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|