| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:34:12 UTC |
|---|
| Update Date | 2025-03-21 17:56:31 UTC |
|---|
| HMDB ID | HMDB0258086 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00001945 |
|---|
| Name | (2S,3S,4S,5R)-3,4,5-Trihydroxy-6-sulfooxyoxane-2-carboxylic acid |
|---|
| Frequency | 3123.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H10O10S |
|---|
| Molecular Mass | 273.9995 |
|---|
| SMILES | O=C(O)C1OC(OS(=O)(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | OQFRCXVRZLHNQY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | glucuronic acid derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfatesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarbonyl groupcarboxylic acidglucuronic acid or derivativesmonosaccharidecarboxylic acid derivativepyran carboxylic acidbeta-hydroxy acidorganic oxidealkyl sulfatealiphatic heteromonocyclic compoundoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesorganic sulfuric acid or derivativeshydroxy acidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholsulfate-esterhydrocarbon derivativesulfuric acid ester |
|---|
