| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:34:13 UTC |
|---|
| Update Date | 2025-03-21 17:56:32 UTC |
|---|
| HMDB ID | HMDB0242132 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00001982 |
|---|
| Name | 2'-O-Methylcytidine |
|---|
| Frequency | 3114.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15N3O5 |
|---|
| Molecular Mass | 257.1012 |
|---|
| SMILES | COC1C(O)C(CO)OC1n1ccc(N)nc1=O |
|---|
| InChI Key | RFCQJGFZUQFYRF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrimidine nucleosides |
|---|
| Subclass | pyrimidine nucleosides |
|---|
| Direct Parent | pyrimidine nucleosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkyl ethersheteroaromatic compoundshydrocarbon derivativesimidolactamsmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespyrimidonessecondary alcoholstetrahydrofurans |
|---|
| Substituents | etheraromatic heteromonocyclic compoundmonosaccharidepyrimidonedialkyl etherpyrimidinesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundpyrimidine nucleosideprimary alcoholimidolactamorganoheterocyclic compoundalcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|