| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:34:17 UTC |
|---|
| Update Date | 2025-03-21 17:56:33 UTC |
|---|
| HMDB ID | HMDB0029938 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00002122 |
|---|
| Name | Acaciabiuronic acid |
|---|
| Frequency | 2871.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H20O12 |
|---|
| Molecular Mass | 356.0955 |
|---|
| SMILES | O=C(O)C1OC(OCC2OC(O)C(O)C(O)C2O)C(O)C(O)C1O |
|---|
| InChI Key | YOOPHLDCWPOWDX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acido-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaliphatic heteromonocyclic compoundhemiacetaloxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativeshydroxy acidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivative |
|---|