| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:34:20 UTC |
|---|
| Update Date | 2025-03-21 17:56:34 UTC |
|---|
| HMDB ID | HMDB0000704 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00002242 |
|---|
| Name | Isoxanthopterin |
|---|
| Frequency | 3149.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H5N5O2 |
|---|
| Molecular Mass | 179.0443 |
|---|
| SMILES | Nc1nc2[nH]c(=O)cnc2c(=O)[nH]1 |
|---|
| InChI Key | GLKCOBIIZKYKFN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrazinespyrimidonesvinylogous amides |
|---|
| Substituents | vinylogous amidepterinlactamazacycleheteroaromatic compoundpyrimidonepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
