| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:34:20 UTC |
|---|
| Update Date | 2025-03-21 17:56:34 UTC |
|---|
| HMDB ID | HMDB0304554 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00002257 |
|---|
| Name | DIMBOA trihexose |
|---|
| Frequency | 2691.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H16NO4+ |
|---|
| Molecular Mass | 190.1074 |
|---|
| SMILES | C[N+](C)(C)C(CCC(=O)O)C(=O)O |
|---|
| InChI Key | WTIGXLNNRAGPIV-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamic acid and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidsaminescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesfatty acids and conjugateshydrocarbon derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundstetraalkylammonium salts |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidtetraalkylammonium saltquaternary ammonium saltfatty acidglutamic acid or derivativesorganic oxideorganic oxygen compoundalpha-amino acidorganonitrogen compounddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltamineorganooxygen compound |
|---|
