| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:34:21 UTC |
|---|
| Update Date | 2025-03-21 17:56:35 UTC |
|---|
| HMDB ID | HMDB0125174 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00002275 |
|---|
| Name | 6-(4-carboxyphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|
| Frequency | 2670.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H14O9 |
|---|
| Molecular Mass | 314.0638 |
|---|
| SMILES | O=C(O)c1ccc(OC2OC(C(=O)O)C(O)C(O)C2O)cc1 |
|---|
| InChI Key | DKNOHNCMCYDVLT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsbenzoic acidsbenzoyl derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesglucuronic acid derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundspyran carboxylic acidssecondary alcohols |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundbenzoylo-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalbenzoic acidoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesbenzoic acid or derivativeshydroxy acidoxacyclepyransecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidphenoxy compound |
|---|
