| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:34:22 UTC |
|---|
| Update Date | 2025-03-21 17:56:35 UTC |
|---|
| HMDB ID | HMDB0246166 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00002319 |
|---|
| Name | Perfluorodecane sulfonic acid |
|---|
| Frequency | 2628.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C10HF21O3S |
|---|
| Molecular Mass | 599.9311 |
|---|
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
| InChI Key | HYWZIAVPBSTISZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfonic acids and derivatives |
|---|
| Subclass | organosulfonic acids and derivatives |
|---|
| Direct Parent | organosulfonic acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluorideshydrocarbon derivativesorganic oxidesorganofluoridessulfonyls |
|---|
| Substituents | aliphatic acyclic compoundalkyl fluorideorganofluorideorganosulfonic acidorganosulfur compoundorganohalogen compoundorganic oxidesulfonylorganic oxygen compoundalkyl halidehydrocarbon derivative |
|---|