Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-20 23:34:22 UTC |
---|
Update Date | 2025-03-21 17:56:35 UTC |
---|
HMDB ID | HMDB0127769 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00002332 |
---|
Name | {2-methoxy-4-[(5-oxooxolan-2-yl)methyl]phenyl}oxidanesulfonic acid |
---|
Frequency | 2612.6 |
---|
Structure | |
---|
Chemical Formula | C12H14O7S |
---|
Molecular Mass | 302.046 |
---|
SMILES | COc1cc(CC2CCC(=O)O2)ccc1OS(=O)(=O)O |
---|
InChI Key | FYRRHCSCZYSADR-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | organic sulfuric acids and derivatives |
---|
Subclass | arylsulfates |
---|
Direct Parent | phenylsulfates |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | alkyl aryl ethersanisolescarbonyl compoundscarboxylic acid estersgamma butyrolactoneshydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsphenoxy compoundssulfuric acid monoesterstetrahydrofurans |
---|
Substituents | phenol ethermonocyclic benzene moietysulfuric acid monoestercarbonyl groupetheraromatic heteromonocyclic compoundalkyl aryl ethercarboxylic acid derivativelactonephenylsulfateorganic oxideorganoheterocyclic compoundtetrahydrofuranmethoxybenzenegamma butyrolactoneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundanisolecarboxylic acid estersulfate-esterhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
---|