Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:34:27 UTC |
---|
Update Date | 2025-03-21 17:56:37 UTC |
---|
HMDB ID | HMDB0304911 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00002531 |
---|
Name | Quinolin-2-yl hydrogen sulfate |
---|
Frequency | 2396.8 |
---|
Structure | |
---|
Chemical Formula | C9H7NO4S |
---|
Molecular Mass | 225.0096 |
---|
SMILES | O=S(=O)(O)Oc1ccc2ccccc2n1 |
---|
InChI Key | UIQFAODJHJZOHK-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | quinolines and derivatives |
---|
Subclass | quinolones and derivatives |
---|
Direct Parent | quinolones and derivatives |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 2-halopyridinesarylsulfatesazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspolyhalopyridinessulfuric acid monoesters |
---|
Substituents | quinolonesulfuric acid monoesterorganic sulfuric acid or derivativesazacyclepolyhalopyridineheteroaromatic compoundhydroxypyridineorganic oxidepyridineorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundsulfate-esterhydrocarbon derivativearylsulfatebenzenoid2-halopyridineorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
---|