| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:34:27 UTC |
|---|
| Update Date | 2025-03-21 17:56:37 UTC |
|---|
| HMDB ID | HMDB0304911 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00002531 |
|---|
| Name | Quinolin-2-yl hydrogen sulfate |
|---|
| Frequency | 2396.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H7NO4S |
|---|
| Molecular Mass | 225.0096 |
|---|
| SMILES | O=S(=O)(O)Oc1ccc2ccccc2n1 |
|---|
| InChI Key | UIQFAODJHJZOHK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | quinolones and derivatives |
|---|
| Direct Parent | quinolones and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesarylsulfatesazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspolyhalopyridinessulfuric acid monoesters |
|---|
| Substituents | quinolonesulfuric acid monoesterorganic sulfuric acid or derivativesazacyclepolyhalopyridineheteroaromatic compoundhydroxypyridineorganic oxidepyridineorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundsulfate-esterhydrocarbon derivativearylsulfatebenzenoid2-halopyridineorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
|---|
