| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:34:28 UTC |
|---|
| Update Date | 2025-03-21 17:56:37 UTC |
|---|
| HMDB ID | HMDB0013318 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00002549 |
|---|
| Name | Tryptophanamide |
|---|
| Frequency | 2498.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H13N3O |
|---|
| Molecular Mass | 203.1059 |
|---|
| SMILES | NC(=O)C(N)Cc1c[nH]c2ccccc12 |
|---|
| InChI Key | JLSKPBDKNIXMBS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acids and derivativesfatty amidesheteroaromatic compoundshydrocarbon derivativesindolesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidespyrroles |
|---|
| Substituents | primary carboxylic acid amidefatty acylcarbonyl groupindolefatty amideorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundazacycleheteroaromatic compoundindole or derivativescarboxamide grouporganic oxygen compoundpyrrolehydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
