| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:34:29 UTC |
|---|
| Update Date | 2025-03-21 17:56:37 UTC |
|---|
| HMDB ID | HMDB0240695 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00002609 |
|---|
| Name | Norepinephrine 3-sulfate |
|---|
| Frequency | 2311.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H11NO6S |
|---|
| Molecular Mass | 249.0307 |
|---|
| SMILES | NCC(O)c1ccc(O)c(OS(=O)(=O)O)c1 |
|---|
| InChI Key | AXVWGBSBINEIHZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaromatic alcoholshydrocarbon derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundssecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | aromatic alcoholalcoholmonocyclic benzene moietysulfuric acid monoester1-hydroxy-2-unsubstituted benzenoidaromatic homomonocyclic compoundphenylsulfateorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundsulfate-esterphenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
