| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:34:30 UTC |
|---|
| Update Date | 2025-03-21 17:56:38 UTC |
|---|
| HMDB ID | HMDB0011686 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00002625 |
|---|
| Name | p-Cresol glucuronide |
|---|
| Frequency | 2292.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H16O7 |
|---|
| Molecular Mass | 284.0896 |
|---|
| SMILES | Cc1ccc(OC2OC(C(=O)O)C(O)C(O)C2O)cc1 |
|---|
| InChI Key | JPAUCQAJHLSMQW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundspyran carboxylic acidssecondary alcoholstoluenes |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundo-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetaloxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativeshydroxy acidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativebenzenoidphenoxy compoundtoluene |
|---|
