| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:34:30 UTC |
|---|
| Update Date | 2025-03-21 17:56:38 UTC |
|---|
| HMDB ID | HMDB0041842 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00002640 |
|---|
| Name | Bufotenin |
|---|
| Frequency | 2280.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H16N2O |
|---|
| Molecular Mass | 204.1263 |
|---|
| SMILES | CN(C)CCc1c[nH]c2ccc(O)cc12 |
|---|
| InChI Key | VTTONGPRPXSUTJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | Not Available |
|---|
| Subclass | alkaloids and derivatives |
|---|
| Direct Parent | alkaloids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesindolesorganooxygen compoundsorganopnictogen compoundspyrrolestrialkylamines |
|---|
| Substituents | azacycleindoleheteroaromatic compoundtertiary aliphatic amine1-hydroxy-2-unsubstituted benzenoidindole or derivativesalkaloid or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundaminetertiary amineorganoheterocyclic compoundorganooxygen compound |
|---|
