| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:34:33 UTC |
|---|
| Update Date | 2025-03-21 17:56:39 UTC |
|---|
| HMDB ID | HMDB0127966 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00002762 |
|---|
| Name | 3-[3-hydroxy-5-methoxy-4-(sulfooxy)phenyl]prop-2-enoic acid |
|---|
| Frequency | 2163.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10O8S |
|---|
| Molecular Mass | 290.0096 |
|---|
| SMILES | COc1cc(C=CC(=O)O)cc(O)c1OS(=O)(=O)O |
|---|
| InChI Key | JOMVUOXGKOHVJF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | hydroxycinnamic acids and derivatives |
|---|
| Direct Parent | hydroxycinnamic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersanisolescarbonyl compoundscarboxylic acidshydrocarbon derivativesmethoxybenzenesmethoxyphenolsmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundsphenylsulfatessulfuric acid monoesters |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupsulfuric acid monoesterethercarboxylic acidmethoxyphenol1-hydroxy-2-unsubstituted benzenoidalkyl aryl ethercarboxylic acid derivativephenylsulfateorganic oxidearylsulfateorganic sulfuric acid or derivatives1-hydroxy-4-unsubstituted benzenoidmethoxybenzenehydroxycinnamic acidaromatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundanisolesulfate-esterphenolhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
