| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:34:34 UTC |
|---|
| Update Date | 2025-03-21 17:56:39 UTC |
|---|
| HMDB ID | HMDB0241215 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00002783 |
|---|
| Name | 2-Dodecenoylcarnitine |
|---|
| Frequency | 2140.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H36NO4+ |
|---|
| Molecular Mass | 342.2639 |
|---|
| SMILES | CCCCCCCCCC=CC(=O)OC(CC(=O)O)C[N+](C)(C)C |
|---|
| InChI Key | OWRLUKFWNGLGIE-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acid esters |
|---|
| Direct Parent | acyl carnitines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | aminescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesenoate estershydrocarbon derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsshort-chain hydroxy acids and derivativestetraalkylammonium salts |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidcarboxylic acid derivativealpha,beta-unsaturated carboxylic esterorganic oxideorganonitrogen compoundorganopnictogen compoundorganic cationorganic saltenoate estertetraalkylammonium saltquaternary ammonium saltacyl-carnitineorganic oxygen compoundcarboxylic acid esterdicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
