| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:34:36 UTC |
|---|
| Update Date | 2025-03-21 17:56:40 UTC |
|---|
| HMDB ID | HMDB0240212 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00002861 |
|---|
| Name | Dimethylguanidino valeric acid |
|---|
| Frequency | 2079.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H15N3O3 |
|---|
| Molecular Mass | 201.1113 |
|---|
| SMILES | CN(C)C(N)=NCCCC(=O)C(=O)O |
|---|
| InChI Key | GLWRPXRMUUZNMD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | keto acids and derivatives |
|---|
| Subclass | short-chain keto acids and derivatives |
|---|
| Direct Parent | short-chain keto acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha-hydroxy ketonesalpha-keto acids and derivativescarboximidamidescarboxylic acidsguanidineshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidguanidineshort-chain keto acidorganic 1,3-dipolar compoundcarboximidamidealpha-hydroxy ketonecarboxylic acid derivativepropargyl-type 1,3-dipolar organic compoundketoneorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundalpha-keto acidorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
