| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:34:38 UTC |
|---|
| Update Date | 2025-03-21 17:56:41 UTC |
|---|
| HMDB ID | HMDB0011731 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00002960 |
|---|
| Name | 5-Keto-D-gluconate |
|---|
| Frequency | 2000.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H10O7 |
|---|
| Molecular Mass | 194.0427 |
|---|
| SMILES | O=C(O)C(O)C(O)C(O)C(=O)CO |
|---|
| InChI Key | IZSRJDGCGRAUAR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | medium-chain hydroxy acids and derivatives |
|---|
| Direct Parent | medium-chain hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acyloinsalpha hydroxy acids and derivativesalpha-hydroxy ketonesbeta hydroxy acids and derivativesbeta-hydroxy ketonescarboxylic acidshydrocarbon derivativeshydroxy fatty acidsmedium-chain fatty acidsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidessecondary alcohols |
|---|
| Substituents | fatty acylbeta-hydroxy ketonealiphatic acyclic compoundcarbonyl groupcarboxylic acidalpha-hydroxy acidmonosaccharidefatty acidalpha-hydroxy ketonecarboxylic acid derivativemedium-chain hydroxy acidketonebeta-hydroxy acidsaccharideorganic oxidemedium-chain fatty acidhydroxy fatty acidalcoholmonocarboxylic acid or derivativesorganic oxygen compoundacyloinsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|