| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:34:40 UTC |
|---|
| Update Date | 2025-03-21 17:56:41 UTC |
|---|
| HMDB ID | HMDB0004326 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00003018 |
|---|
| Name | 2'-O-Methyladenosine |
|---|
| Frequency | 1968.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H15N5O4 |
|---|
| Molecular Mass | 281.1124 |
|---|
| SMILES | COC1C(O)C(CO)OC1n1cnc2c(N)ncnc21 |
|---|
| InChI Key | FPUGCISOLXNPPC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine nucleosides |
|---|
| Direct Parent | purine nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkyl ethersheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonosaccharidesn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | ethermonosaccharideimidazopyrimidinedialkyl etherpyrimidinesaccharidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranpurine nucleosideheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|